Online Database of Chemicals from Around the World
|
CAS#: 5633-57-8 Product: 1-Methoxy-4-(Phenylthio)-Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-(Phenylthio)-Benzene |
|---|---|
| Synonyms | 1-Methoxy-4-Phenylsulfanyl-Benzene; 1-Methoxy-4-(Phenylthio)Benzene; Benzene,1-Methoxy-4-(Phenylthio)- |
| Molecular Structure |  |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.30 |
| CAS Registry Number | 5633-57-8 |
| SMILES | C2=C(SC1=CC=CC=C1)C=CC(=C2)OC |
| InChI | 1S/C13H12OS/c1-14-11-7-9-13(10-8-11)15-12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | QLPJEUPWCYCFKB-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.712°C at 760 mmHg (Cal.) |
| Flash point | 165.905°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-(Phenylthio)-Benzene |