Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Zoliprofen |
|---|---|
| Synonyms | 2-(4-Thiazol-2-Yloxyphenyl)Propanoic Acid; 2-[4-(2-Thiazolyloxy)Phenyl]Propanoic Acid; 2-(4-Thiazol-2-Yloxyphenyl)Propionic Acid |
| Molecular Structure |  |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.28 |
| CAS Registry Number | 56355-17-0 |
| SMILES | C1=CC(=CC=C1OC2=NC=CS2)C(C(O)=O)C |
| InChI | 1S/C12H11NO3S/c1-8(11(14)15)9-2-4-10(5-3-9)16-12-13-6-7-17-12/h2-8H,1H3,(H,14,15) |
| InChIKey | RXZTWBVFHQLTBU-UHFFFAOYSA-N |
| Density | 1.33g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.358°C at 760 mmHg (Cal.) |
| Flash point | 204.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zoliprofen |