Online Database of Chemicals from Around the World
|
CAS#: 56409-09-7 Product: N,N'-Dichloro-N,N'-Dinitro-1,6-Hexanediamine No suppilers available for the product. |
| Name | N,N'-Dichloro-N,N'-Dinitro-1,6-Hexanediamine |
|---|---|
| Synonyms | N-Chloro-N-[6-(Chloro-Nitro-Amino)Hexyl]Nitramide; 1,6-Hexanediamine, N,N'-Dichloro-N,N'-Dinitro-; Brn 1983323 |
| Molecular Structure |  |
| Molecular Formula | C6H12Cl2N4O4 |
| Molecular Weight | 275.09 |
| CAS Registry Number | 56409-09-7 |
| SMILES | C(N([N+](=O)[O-])Cl)CCCCCN([N+](=O)[O-])Cl |
| InChI | 1S/C6H12Cl2N4O4/c7-9(11(13)14)5-3-1-2-4-6-10(8)12(15)16/h1-6H2 |
| InChIKey | CDQHTUJEZDURJI-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.723°C at 760 mmHg (Cal.) |
| Flash point | 194.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Dichloro-N,N'-Dinitro-1,6-Hexanediamine |