Online Database of Chemicals from Around the World
|
CAS#: 56510-51-1 Product: Cesium Trichloroacetate No suppilers available for the product. |
| Name | Cesium Trichloroacetate |
|---|---|
| Synonyms | Cesium 2,2,2-Trichloroethanoate; Cesium Trichloroacetate |
| Molecular Structure |  |
| Molecular Formula | C2Cl3CsO2 |
| Molecular Weight | 295.29 |
| CAS Registry Number | 56510-51-1 |
| EINECS | 260-234-6 |
| SMILES | O=C([O-])C(Cl)(Cl)Cl.[Cs+] |
| InChI | 1S/C2HCl3O2.Cs/c3-2(4,5)1(6)7;/h(H,6,7);/q;+1/p-1 |
| InChIKey | UENNGPNWLNXHDS-UHFFFAOYSA-M |
| Boiling point | 196.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 66.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cesium Trichloroacetate |