| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,3,5-Trimethyl-5,6-Dihydro-2(1H)-Pyrazinone 4-Oxide |
|---|---|
| Synonyms | 2,4,6-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 |
| CAS Registry Number | 566155-32-6 |
| SMILES | CC1CN(C(=O)C(=[N+]1[O-])C)C |
| InChI | 1S/C7H12N2O2/c1-5-4-8(3)7(10)6(2)9(5)11/h5H,4H2,1-3H3 |
| InChIKey | INEYZTIREFOTME-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.8±23.0°C at 760 mmHg (Cal.) |
| Flash point | 109.1±22.6°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| (1) | Frances Heaney, Julie Fenlon, Patrick McArdle and Desmond Cunningham. a-Keto amides as precursors to heterocycles—generation and cycloaddition reactions of piperazin-5-one nitrones, Org. Biomol. Chem., 2003, 1, 1122. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethyl-5,6-Dihydro-2(1H)-Pyrazinone 4-Oxide |