Online Database of Chemicals from Around the World
|
CAS#: 56652-39-2 Product: Dimethyl 3-Hydroxy-3-Methylglutarate No suppilers available for the product. |
| Name | Dimethyl 3-Hydroxy-3-Methylglutarate |
|---|---|
| Synonyms | Dimethyl 3-Hydroxy-3-Methyl-Pentanedioate; 3-Hydroxy-3-Methylpentanedioic Acid Dimethyl Ester; 3-Hydroxy-3-Methyl-Glutaric Acid Dimethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 56652-39-2 |
| EINECS | 260-314-0 |
| SMILES | C(C(CC(=O)OC)(O)C)C(=O)OC |
| InChI | 1S/C8H14O5/c1-8(11,4-6(9)12-2)5-7(10)13-3/h11H,4-5H2,1-3H3 |
| InChIKey | ANEMYUYZEOZEJW-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.627°C at 760 mmHg (Cal.) |
| Flash point | 103.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 3-Hydroxy-3-Methylglutarate |