Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(3,4,5-Trimethoxyphenyl)Sulfuric Diamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H14N2O5S |
| Molecular Weight | 262.28 |
| CAS Registry Number | 56663-86-6 |
| SMILES | COc1cc(cc(c1OC)OC)NS(=O)(=O)N |
| InChI | 1S/C9H14N2O5S/c1-14-7-4-6(11-17(10,12)13)5-8(15-2)9(7)16-3/h4-5,11H,1-3H3,(H2,10,12,13) |
| InChIKey | HNFRTQWBYUTOJA-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.691°C at 760 mmHg (Cal.) |
| Flash point | 199.76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3,4,5-Trimethoxyphenyl)Sulfuric Diamide |