Online Database of Chemicals from Around the World
| Name | 4-Acetoxy-3-Methoxybenzoyl Chloride |
|---|---|
| Synonyms | (4-Chlorocarbonyl-2-Methoxy-Phenyl) Acetate; Acetic Acid (4-Chlorocarbonyl-2-Methoxyphenyl) Ester; Acetic Acid (4-Chlorocarbonyl-2-Methoxy-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.63 |
| CAS Registry Number | 56681-66-4 |
| EINECS | 260-336-0 |
| SMILES | C1=C(C(=O)Cl)C=CC(=C1OC)OC(=O)C |
| InChI | 1S/C10H9ClO4/c1-6(12)15-8-4-3-7(10(11)13)5-9(8)14-2/h3-5H,1-2H3 |
| InChIKey | YRZKSSFRGXBQKU-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.731°C at 760 mmHg (Cal.) |
| Flash point | 125.229°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetoxy-3-Methoxybenzoyl Chloride |
