Online Database of Chemicals from Around the World
|
CAS#: 5676-29-9 Product: (1-Tert-Butylvinyl)Benzene No suppilers available for the product. |
| Name | (1-Tert-Butylvinyl)Benzene |
|---|---|
| Synonyms | (2,2-Dimethyl-1-Methylene-Propyl)Benzene; (2,2-Dimethyl-1-Methylenepropyl)Benzene; 1-Tert-Butylvinylbenzene |
| Molecular Structure |  |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 |
| CAS Registry Number | 5676-29-9 |
| SMILES | C1=C(C(C(C)(C)C)=C)C=CC=C1 |
| InChI | 1S/C12H16/c1-10(12(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3 |
| InChIKey | OJHQXSRIBZMCSR-UHFFFAOYSA-N |
| Density | 0.867g/cm3 (Cal.) |
|---|---|
| Boiling point | 214.862°C at 760 mmHg (Cal.) |
| Flash point | 76.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Tert-Butylvinyl)Benzene |