Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Penthrichloral |
|---|---|
| Synonyms | [5-Methylol-2-(Trichloromethyl)-1,3-Dioxan-5-Yl]Methanol; Penthrichloralum [Inn-Latin]; Pentrichloralum |
| Molecular Structure |  |
| Molecular Formula | C7H11Cl3O4 |
| Molecular Weight | 265.52 |
| CAS Registry Number | 5684-90-2 |
| EINECS | 227-151-7 |
| SMILES | C(C1(COC(C(Cl)(Cl)Cl)OC1)CO)O |
| InChI | 1S/C7H11Cl3O4/c8-7(9,10)5-13-3-6(1-11,2-12)4-14-5/h5,11-12H,1-4H2 |
| InChIKey | QMSJBEPHXPSJPT-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.711°C at 760 mmHg (Cal.) |
| Flash point | 173.766°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Penthrichloral |