Online Database of Chemicals from Around the World
|
CAS#: 56857-64-8 Product: 2-(3a,5a-Dimethyl-6,7,8,9-tetrahydro-5H-furo[2,3-i][2]benzofuran-8-yl)propan-2-ol No suppilers available for the product. |
| Name | 2-(3a,5a-Dimethyl-6,7,8,9-tetrahydro-5H-furo[2,3-i][2]benzofuran-8-yl)propan-2-ol |
|---|---|
| Molecular Structure | ![CAS#: 56857-64-8， 2-(3a,5a-Dimethyl-6,7,8,9-tetrahydro-5H-furo[2,3-i][2]benzofuran-8-yl)propan-2-ol](/moreStructures/56857-64-8.gif) |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 |
| CAS Registry Number | 56857-64-8 |
| SMILES | [C@]13(C2([C@](OC1)(C=CO2)C)C[C@H](C(O)(C)C)CC3)C |
| InChI | 1S/C15H24O3/c1-12(2,16)11-5-6-13(3)10-18-14(4)7-8-17-15(13,14)9-11/h7-8,11,16H,5-6,9-10H2,1-4H3/t11-,13+,14-,15?/m1/s1 |
| InChIKey | ZOEXGOVAOFIZLY-BMGQEUAGSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.264°C at 760 mmHg (Cal.) |
| Flash point | 167.448°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3a,5a-Dimethyl-6,7,8,9-tetrahydro-5H-furo[2,3-i][2]benzofuran-8-yl)propan-2-ol |