Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
|
+31 (15) 251-8111 | |||
|
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 1,4,5,8-Naphthalenetetracarboxdiimide |
|---|---|
| Synonyms | Nciopen2_007082; 1,4,5,8-Naphthalenetetracarboxylic 1,8: 4,5-Diimide; Aids074604 |
| Molecular Structure |  |
| Molecular Formula | C14H6N2O4 |
| Molecular Weight | 266.21 |
| CAS Registry Number | 5690-24-4 |
| EINECS | 227-159-0 |
| SMILES | C3=C1C(=O)NC(=O)C4=C1C2=C(C(=O)NC(=O)C2=C3)C=C4 |
| InChI | 1S/C14H6N2O4/c17-11-5-1-2-6-10-8(14(20)16-12(6)18)4-3-7(9(5)10)13(19)15-11/h1-4H,(H,15,17,19)(H,16,18,20) |
| InChIKey | BODUWJSFPLUDMP-UHFFFAOYSA-N |
| Density | 1.666g/cm3 (Cal.) |
|---|---|
| Boiling point | 702.836°C at 760 mmHg (Cal.) |
| Flash point | 311.142°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,4,5,8-Naphthalenetetracarboxdiimide |