Online Database of Chemicals from Around the World
|
CAS#: 5702-40-9 Product: 2-Nitro-2-Ethyl-1,3-Propanediol butyraldehyde acetal No suppilers available for the product. |
| Name | 2-Nitro-2-Ethyl-1,3-Propanediol butyraldehyde acetal |
|---|---|
| Synonyms | 1,3-Dioxane, 5-Ethyl-5-Nitro-2-Propyl- (9Ci); 2-Nitro-2-Ethyl-1,3-Propanediol Butyraldehyde Acetal; 4-19-00-00092 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 5702-40-9 |
| SMILES | C(C1([N+]([O-])=O)COC(OC1)CCC)C |
| InChI | 1S/C9H17NO4/c1-3-5-8-13-6-9(4-2,7-14-8)10(11)12/h8H,3-7H2,1-2H3 |
| InChIKey | MPWDGAHTGODYEE-UHFFFAOYSA-N |
| Density | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.942°C at 760 mmHg (Cal.) |
| Flash point | 116.598°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-2-Ethyl-1,3-Propanediol butyraldehyde acetal |