| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Metal halides and halides >> Non-metal halide, sulfide or sulfonate |
|---|---|
| Name | Disulphur Decafluoride |
| Synonyms | Sulfur Decafluoride; Sulfur Pentafluoride |
| Molecular Structure | ![]() |
| Molecular Formula | F10S2 |
| Molecular Weight | 254.10 |
| CAS Registry Number | 5714-22-7 |
| EINECS | 227-204-4 |
| SMILES | F[S](F)(F)([S](F)(F)(F)(F)F)(F)F |
| InChI | 1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10 |
| InChIKey | BPFZRKQDXVZTFD-UHFFFAOYSA-N |
| Boiling point | 28.8889°C (Expl.) |
|---|---|
| solubility | Insoluble |
| Market Analysis Reports |
| List of Reports Available for Disulphur Decafluoride |