| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Chromaphon |
|---|---|
| Synonyms | 3-Diethoxythiophosphoryloxy-7,8,9,10-Tetrahydrobenzo[C]Chromen-6-One; 1-Cyclohexene-1-Carboxylic Acid, 2-(2,4-Dihydorxyphenyl)-, Delta-Lactone, O,O-Diethyl Phosphorothioate; 1-Cyclohexene-1-Carboxylic Acid, 2-(2,4-Dihydroxyphenyl)-, Delta-Lactone, O-Ester With O,O-Diethyl Phosphorothioate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21O5PS |
| Molecular Weight | 368.38 |
| CAS Registry Number | 572-48-5 |
| SMILES | C1=C2C(=CC=C1O[P](=S)(OCC)OCC)C3=C(C(=O)O2)CCCC3 |
| InChI | 1S/C17H21O5PS/c1-3-19-23(24,20-4-2)22-12-9-10-14-13-7-5-6-8-15(13)17(18)21-16(14)11-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | NSMRHYDOKZAMKJ-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.871°C at 760 mmHg (Cal.) |
| Flash point | 247.646°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chromaphon |