Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Methylsulfonyloxyisoindole-1,3-Dione |
|---|---|
| Synonyms | (1,3-Dioxoisoindolin-2-Yl) Methanesulfonate; Methanesulfonic Acid (1,3-Dioxo-2-Isoindolinyl) Ester; Methanesulfonic Acid (1,3-Diketoisoindolin-2-Yl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H7NO5S |
| Molecular Weight | 241.22 |
| CAS Registry Number | 57212-70-1 |
| SMILES | C1=CC=CC2=C1C(N(C2=O)O[S](C)(=O)=O)=O |
| InChI | 1S/C9H7NO5S/c1-16(13,14)15-10-8(11)6-4-2-3-5-7(6)9(10)12/h2-5H,1H3 |
| InChIKey | MZVIAOIHWLOXPX-UHFFFAOYSA-N |
| Density | 1.641g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.925°C at 760 mmHg (Cal.) |
| Flash point | 201.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylsulfonyloxyisoindole-1,3-Dione |