Online Database of Chemicals from Around the World
|
CAS#: 57266-83-8 Product: 3-Hydroxy-7,12-Dimethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 3-Hydroxy-7,12-Dimethylbenz(a)Anthracene |
|---|---|
| Synonyms | 7,12-Dimethyl-3-Benzo[H]Phenanthrenol; Benz(A)Anthracen-3-Ol, 7,12-Dimethyl-; Brn 2282656 |
| Molecular Structure |  |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 |
| CAS Registry Number | 57266-83-8 |
| SMILES | C2=C1C(=C4C(=C(C1=CC=C2)C)C3=CC=C(C=C3C=C4)O)C |
| InChI | 1S/C20H16O/c1-12-16-5-3-4-6-17(16)13(2)20-18(12)9-7-14-11-15(21)8-10-19(14)20/h3-11,21H,1-2H3 |
| InChIKey | BQLIXGXXAQHBPX-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.904°C at 760 mmHg (Cal.) |
| Flash point | 247.732°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-7,12-Dimethylbenz(a)Anthracene |