| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | trans-1,1,1,2,2,3,3-Heptafluoro-4-Nonene |
|---|---|
| Synonyms | TRANS-1,1,1,2,2,3,3-HEPTAFLUORO-4-NONENE; TRANS-1,1,1,2,2,3,3-HEPTAFLUORONON-4-ENE; 1,1,1,2,2,3,3-HEPTAFLUORO-4-NONENE TRANS |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11F7 |
| Molecular Weight | 252.17 |
| CAS Registry Number | 57325-40-3 |
| SMILES | CCCC/C=C/C(C(C(F)(F)F)(F)F)(F)F |
| InChI | 1S/C9H11F7/c1-2-3-4-5-6-7(10,11)8(12,13)9(14,15)16/h5-6H,2-4H2,1H3/b6-5+ |
| Market Analysis Reports |
| List of Reports Available for trans-1,1,1,2,2,3,3-Heptafluoro-4-Nonene |