| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Watanabe Chemical Ind., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() |
+81 (82) 231-0540 | |||
![]() |
inquiry@watanabechem.co.jp | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Valine derivatives |
|---|---|
| Name | N-Acetylnorvaline |
| Synonyms | (2R)-2-Acetamidovalerate; Zinc04763053 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12NO3 |
| Molecular Weight | 158.18 |
| CAS Registry Number | 57357-56-9 |
| SMILES | [C@H](NC(=O)C)(C([O-])=O)CCC |
| InChI | 1S/C7H13NO3/c1-3-4-6(7(10)11)8-5(2)9/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/p-1/t6-/m1/s1 |
| InChIKey | BSYFPUSAWVWWDG-ZCFIWIBFSA-M |
| Boiling point | 371.802°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 178.66°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetylnorvaline |