Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,5-Dihydroxybenzyl Valerate |
|---|---|
| Synonyms | 3,5-dihydroxybenzyl pentanoate |
| Molecular Structure |  |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25 |
| CAS Registry Number | 573981-61-0 |
| SMILES | CCCCC(=O)OCc1cc(cc(c1)O)O |
| InChI | 1S/C12H16O4/c1-2-3-4-12(15)16-8-9-5-10(13)7-11(14)6-9/h5-7,13-14H,2-4,8H2,1H3 |
| InChIKey | DOHOZOMWVBUZCC-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.177°C at 760 mmHg (Cal.) |
| Flash point | 137.779°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dihydroxybenzyl Valerate |