|
CAS#: 574738-66-2 Product: 2-Amino-4,5-Bis(2-Methoxyethoxy)Benzoic Acid No suppilers available for the product. |
| Name | 2-Amino-4,5-Bis(2-Methoxyethoxy)Benzoic Acid |
|---|---|
| Synonyms | 2-Amino-4,5-bis-(2-methoxy-ethoxy)-benzoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.29 |
| CAS Registry Number | 574738-66-2 |
| SMILES | OC(=O)c1cc(OCCOC)c(OCCOC)cc1N |
| InChI | 1S/C13H19NO6/c1-17-3-5-19-11-7-9(13(15)16)10(14)8-12(11)20-6-4-18-2/h7-8H,3-6,14H2,1-2H3,(H,15,16) |
| InChIKey | HUJDMSWRGMPHJD-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.788°C at 760 mmHg (Cal.) |
| Flash point | 229.453°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-4,5-Bis(2-Methoxyethoxy)Benzoic Acid |