Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Cinnamyl Acetoacetate |
|---|---|
| Synonyms | 3-Oxobutanoic Acid [(Z)-3-Phenylprop-2-Enyl] Ester; 3-Ketobutyric Acid [(Z)-3-Phenylprop-2-Enyl] Ester; Cinnamyl Acetoacetate |
| Molecular Structure |  |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 57582-46-4 |
| EINECS | 260-826-4 |
| SMILES | C1=C(\C=C/COC(CC(=O)C)=O)C=CC=C1 |
| InChI | 1S/C13H14O3/c1-11(14)10-13(15)16-9-5-8-12-6-3-2-4-7-12/h2-8H,9-10H2,1H3/b8-5- |
| InChIKey | BDCAQAAKRKWXFW-YVMONPNESA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.142°C at 760 mmHg (Cal.) |
| Flash point | 158.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cinnamyl Acetoacetate |