Online Database of Chemicals from Around the World
|
CAS#: 57648-76-7 Product: N-(1,2-Dimethylethenylenedioxyphosphoryl)Imidazole No suppilers available for the product. |
| Name | N-(1,2-Dimethylethenylenedioxyphosphoryl)Imidazole |
|---|---|
| Synonyms | 2-(1-Imidazolyl)-4,5-Dimethyl-1,3-Dioxa-2$L^{5}-Phosphacyclopent-4-Ene 2-Oxide; Nsc292945; Zinc01566125 |
| Molecular Structure |  |
| Molecular Formula | C7H9N2O3P |
| Molecular Weight | 200.13 |
| CAS Registry Number | 57648-76-7 |
| SMILES | C1=CN=C[N]1[P]2(OC(=C(O2)C)C)=O |
| InChI | 1S/C7H9N2O3P/c1-6-7(2)12-13(10,11-6)9-4-3-8-5-9/h3-5H,1-2H3 |
| InChIKey | XTSDWAKWBYCFFE-UHFFFAOYSA-N |
| Density | 1.508g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.136°C at 760 mmHg (Cal.) |
| Flash point | 178.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1,2-Dimethylethenylenedioxyphosphoryl)Imidazole |