|
CAS#: 57658-79-4 Product: 1,4-Dimethyl-5-Nitro-Imidazole No suppilers available for the product. |
| Name | 1,4-Dimethyl-5-Nitro-Imidazole |
|---|---|
| Synonyms | 1,4-Dimethyl-5-Nitro-Imidazole; 1,4-Dimethyl-5-Nitro-1H-Imidazole (9Ci); 5-23-05-00099 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 |
| CAS Registry Number | 57658-79-4 |
| SMILES | C1=NC(=C([N]1C)[N+]([O-])=O)C |
| InChI | 1S/C5H7N3O2/c1-4-5(8(9)10)7(2)3-6-4/h3H,1-2H3 |
| InChIKey | FEGUTYIXCZDKJV-UHFFFAOYSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.959°C at 760 mmHg (Cal.) |
| Flash point | 149.12°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Dimethyl-5-Nitro-Imidazole |