Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Phenylcyclohexanecarbonyl Fluoride |
|---|---|
| Synonyms | 1-phenylcyclohexanecarbonyl fluoride |
| Molecular Structure |  |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 |
| CAS Registry Number | 577034-59-4 |
| SMILES | c1ccc(cc1)C2(CCCCC2)C(=O)F |
| InChI | 1S/C13H15FO/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | XRVRUVINBQNODP-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.044°C at 760 mmHg (Cal.) |
| Flash point | 114.243°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylcyclohexanecarbonyl Fluoride |