|
CAS#: 5786-77-6 Product: 3,3-Di-2-thienyl-N,N,1-trimethylallylamine hydrochloride No suppilers available for the product. |
| Name | 3,3-Di-2-thienyl-N,N,1-trimethylallylamine hydrochloride |
|---|---|
| Synonyms | Dimethyl-[1-Methyl-3,3-Bis(2-Thienyl)Prop-2-Enyl]Ammonium Chloride; 4,4-Dithiophen-2-Ylbut-3-En-2-Yl-Dimethyl-Azanium Chloride; 3,3-Di-2-Thienyl-N,N,1-Trimethylallylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18ClNS2 |
| Molecular Weight | 299.88 |
| CAS Registry Number | 5786-77-6 |
| SMILES | C2=C(C(C1=CC=CS1)=CC([NH+](C)C)C)SC=C2.[Cl-] |
| InChI | 1S/C14H17NS2.ClH/c1-11(15(2)3)10-12(13-6-4-8-16-13)14-7-5-9-17-14;/h4-11H,1-3H3;1H |
| InChIKey | OBFGNODOJKVYIR-UHFFFAOYSA-N |
| Boiling point | 371.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 178.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Di-2-thienyl-N,N,1-trimethylallylamine hydrochloride |