Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 6-Acetoxydihydrotheaspirane |
|---|---|
| Synonyms | Acetic Acid (2,6,6,10-Tetramethyl-1-Oxaspiro[4.5]Decan-10-Yl) Ester; (2,6,6,10-Tetramethyl-1-Oxaspiro[4.5]Decan-10-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 |
| CAS Registry Number | 57893-27-3 |
| EINECS | 261-005-3 |
| FEMA | 3651 |
| SMILES | CC1(C2(C(CCC1)(C)C)OC(C)CC2)OC(C)=O |
| InChI | 1S/C15H26O3/c1-11-7-10-15(17-11)13(3,4)8-6-9-14(15,5)18-12(2)16/h11H,6-10H2,1-5H3 |
| InChIKey | LTAWGWRPOGXHBD-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.616°C at 760 mmHg (Cal.) |
| Flash point | 126.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Acetoxydihydrotheaspirane |