Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Calcium Diphenoxide |
|---|---|
| Synonyms | Calcium Phenoxide |
| Molecular Structure |  |
| Molecular Formula | C12H10CaO2 |
| Molecular Weight | 226.29 |
| CAS Registry Number | 5793-84-0 |
| EINECS | 227-331-5 |
| SMILES | C1=C([O-])C=CC=C1.C2=C([O-])C=CC=C2.[Ca++] |
| InChI | 1S/2C6H6O.Ca/c2*7-6-4-2-1-3-5-6;/h2*1-5,7H;/q;;+2/p-2 |
| InChIKey | ZMRQTIAUOLVKOX-UHFFFAOYSA-L |
| Boiling point | 181.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Calcium Diphenoxide |