Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-(3-Cyanophenyl)-1,1,1-Trifluoromethanesulfonamide |
|---|---|
| Synonyms | N-(3-cyanophenyl)-1,1,1-trifluoromethanesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 |
| CAS Registry Number | 57946-16-4 |
| SMILES | c1cc(cc(c1)NS(=O)(=O)C(F)(F)F)C#N |
| InChI | 1S/C8H5F3N2O2S/c9-8(10,11)16(14,15)13-7-3-1-2-6(4-7)5-12/h1-4,13H |
| InChIKey | GAWNAOZVTUPTGS-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.146°C at 760 mmHg (Cal.) |
| Flash point | 129.881°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Cyanophenyl)-1,1,1-Trifluoromethanesulfonamide |