Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Nitro-2-Pyridinecarbonyl Chloride 1-Oxide |
|---|---|
| Synonyms | 2-(chlorocarbonyl)-4-nitropyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C6H3ClN2O4 |
| Molecular Weight | 202.55 |
| CAS Registry Number | 57948-55-7 |
| SMILES | c1c[n+](c(cc1[N+](=O)[O-])C(=O)Cl)[O-] |
| InChI | 1S/C6H3ClN2O4/c7-6(10)5-3-4(9(12)13)1-2-8(5)11/h1-3H |
| InChIKey | KQCBMLQHJTWRKM-UHFFFAOYSA-N |
| Density | 1.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.634°C at 760 mmHg (Cal.) |
| Flash point | 226.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-2-Pyridinecarbonyl Chloride 1-Oxide |