| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() | www.hoffmanchemicals.com | |||
![]() | +61 3-7003-5401 | |||
![]() | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 2-(4-Cyanobenzoyl)pyridine |
|---|---|
| Synonyms | 4-(pyridine-2-carbonyl)benzonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.22 |
| CAS Registry Number | 57954-94-6 |
| SMILES | C1=CC=NC(=C1)C(=O)C2=CC=C(C=C2)C#N |
| Solubility | 0.5813 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.555, Calc.* |
| Melting point | 42.31 °C |
| Boiling Point | 305.94 °C, 295.1±10.0 °C (760 mmHg), Calc.* |
| Flash Point | 134.3±9.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Cyanobenzoyl)pyridine |