Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Methoxy-5-Methyl-2-Biphenylol |
|---|---|
| Synonyms | 3-methoxy-5-methyl-[1,1'-biphenyl]-2-ol |
| Molecular Structure |  |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 58005-45-1 |
| SMILES | Cc1cc(c(c(c1)OC)O)c2ccccc2 |
| InChI | 1S/C14H14O2/c1-10-8-12(11-6-4-3-5-7-11)14(15)13(9-10)16-2/h3-9,15H,1-2H3 |
| InChIKey | SEVCHKPZOWJMSH-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.778°C at 760 mmHg (Cal.) |
| Flash point | 154.885°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-5-Methyl-2-Biphenylol |