Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Acridin-3-Ylamine |
|---|---|
| Synonyms | 3-Acridinamine; Acridin-3-Ylamine; 3-Aminoakridin [Czech] |
| Molecular Structure |  |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 |
| CAS Registry Number | 581-29-3 |
| EINECS | 209-461-4 |
| SMILES | C1=C3C(=NC2=C1C=CC=C2)C=C(N)C=C3 |
| InChI | 1S/C13H10N2/c14-11-6-5-10-7-9-3-1-2-4-12(9)15-13(10)8-11/h1-8H,14H2 |
| InChIKey | GHCKERHPOQWERJ-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.162°C at 760 mmHg (Cal.) |
| Flash point | 241.23°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acridin-3-Ylamine |