Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-(Ethylamino)-1,3-Benzothiazole-2(3H)-Thione |
|---|---|
| Synonyms | 6-(ethylamino)benzo[d]thiazole-2(3H)-thione |
| Molecular Structure |  |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 58106-94-8 |
| SMILES | CCNc1ccc2c(c1)sc(=S)[nH]2 |
| InChI | 1S/C9H10N2S2/c1-2-10-6-3-4-7-8(5-6)13-9(12)11-7/h3-5,10H,2H2,1H3,(H,11,12) |
| InChIKey | SAKWHKDCVMIEMZ-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.876°C at 760 mmHg (Cal.) |
| Flash point | 192.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Ethylamino)-1,3-Benzothiazole-2(3H)-Thione |