Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-Acetylnaphthalene-1,4-Dione |
|---|---|
| Synonyms | 2-Acetyl-1,4-Naphthoquinone; 2-Ethanoylnaphthalene-1,4-Dione; Nsc111550 |
| Molecular Structure |  |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 5813-57-0 |
| SMILES | C1=CC2=C(C=C1)C(=O)C(=CC2=O)C(=O)C |
| InChI | 1S/C12H8O3/c1-7(13)10-6-11(14)8-4-2-3-5-9(8)12(10)15/h2-6H,1H3 |
| InChIKey | LKDQLNOZQAMIOG-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.088°C at 760 mmHg (Cal.) |
| Flash point | 165.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetylnaphthalene-1,4-Dione |