| Dafeng Chemical Com.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.qzdafeng.cn | |||
![]() | +86 16773308882 | |||
![]() | 927608786@qq.com | |||
![]() | QQ Chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 4-Bromo-5-nitroisoquinoline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H5BrN2O2 |
| Molecular Weight | 253.05 |
| CAS Registry Number | 58142-46-4 |
| SMILES | C1=CC2=CN=CC(=C2C(=C1)[N+](=O)[O-])Br |
| Solubility | 34.1 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.707, Calc.* |
| Melting point | 127.62 °C |
| Boiling Point | 349.22 °C, 379.9±27.0 °C (760 mmHg), Calc.* |
| Flash Point | 183.6±23.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-5-nitroisoquinoline |