|
CAS#: 581812-72-8 Product: Methyl 5-Nitro-3-Isoquinolinecarboxylate No suppilers available for the product. |
| Name | Methyl 5-Nitro-3-Isoquinolinecarboxylate |
|---|---|
| Synonyms | Methyl 5-nitro-3-isoquinolinecarboxylate |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.19 |
| CAS Registry Number | 581812-72-8 |
| SMILES | O=N(=O)c2cccc1cnc(cc12)C(=O)OC |
| InChI | 1S/C11H8N2O4/c1-17-11(14)9-5-8-7(6-12-9)3-2-4-10(8)13(15)16/h2-6H,1H3 |
| InChIKey | BYMILMIMXOKQBF-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.328°C at 760 mmHg (Cal.) |
| Flash point | 209.216°C (Cal.) |
| Refractive index | 1.647 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5-Nitro-3-Isoquinolinecarboxylate |