Online Database of Chemicals from Around the World
|
CAS#: 58243-84-8 Product: 1,1,4,4-Tetramethyl-6-Ethyl-7-Chloromethyltetralin No suppilers available for the product. |
| Name | 1,1,4,4-Tetramethyl-6-Ethyl-7-Chloromethyltetralin |
|---|---|
| Synonyms | 6-(Chloromethyl)-7-Ethyl-1,1,4,4-Tetramethyl-Tetralin; 6-(Chloromethyl)-7-Ethyl-1,1,4,4-Tetramethyltetralin; 1,1,4,4-Tetramethyl-6-Ethyl-7-Chloromethyltetralin |
| Molecular Structure |  |
| Molecular Formula | C17H25Cl |
| Molecular Weight | 264.84 |
| CAS Registry Number | 58243-84-8 |
| SMILES | C1=C(CC)C(=CC2=C1C(CCC2(C)C)(C)C)CCl |
| InChI | 1S/C17H25Cl/c1-6-12-9-14-15(10-13(12)11-18)17(4,5)8-7-16(14,2)3/h9-10H,6-8,11H2,1-5H3 |
| InChIKey | ODQIDWUAORJLDJ-UHFFFAOYSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.873°C at 760 mmHg (Cal.) |
| Flash point | 142.914°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,4,4-Tetramethyl-6-Ethyl-7-Chloromethyltetralin |