Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 13alpha-Cinnamoyloxylupanine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 |
| CAS Registry Number | 5835-04-1 |
| EINECS | 227-420-9 |
| SMILES | [C@@H]13[C@H]4N(C[C@@H]([C@@H]2N(C1)C(=O)CCC2)C3)CC[C@@H](C4)OC(\C=C\C5=CC=CC=C5)=O |
| InChI | 1S/C24H30N2O3/c27-23-8-4-7-21-18-13-19(16-26(21)23)22-14-20(11-12-25(22)15-18)29-24(28)10-9-17-5-2-1-3-6-17/h1-3,5-6,9-10,18-22H,4,7-8,11-16H2/b10-9+/t18-,19-,20-,21+,22-/m0/s1 |
| InChIKey | PUFYZCKVLOYPHL-MFYPYBFPSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 566.546°C at 760 mmHg (Cal.) |
| Flash point | 296.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13alpha-Cinnamoyloxylupanine |