Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Phenylazobenzenesulfonyl Chloride |
|---|---|
| Synonyms | 4-Phenylazobenzenesulfonyl Chloride; Benzenesulfonyl Chloride, 4-(Phenylazo)- |
| Molecular Structure |  |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.73 |
| CAS Registry Number | 58359-53-8 |
| SMILES | C1=C(C=CC(=C1)[S](=O)(=O)Cl)N=NC2=CC=CC=C2 |
| InChI | 1S/C12H9ClN2O2S/c13-18(16,17)12-8-6-11(7-9-12)15-14-10-4-2-1-3-5-10/h1-9H |
| InChIKey | UEAZPVORQYDKHZ-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Melting point | 122°C (Expl.) |
| Boiling point | 418.929°C at 760 mmHg (Cal.) |
| Flash point | 207.161°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Phenylazobenzenesulfonyl Chloride |