Online Database of Chemicals from Around the World
|
CAS#: 58394-64-2 Product: Benzyl 2-Ethylhexyl Adipate No suppilers available for the product. |
| Name | Benzyl 2-Ethylhexyl Adipate |
|---|---|
| Synonyms | Hexanedioic Acid 2-Ethylhexyl Ester Phenylmethyl Ester; Adipic Acid 2-Ethylhexyl Ester Benzyl Ester; Benzyl 2-Ethylhexyl Adipate |
| Molecular Structure |  |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 |
| CAS Registry Number | 58394-64-2 |
| EINECS | 261-234-9 |
| SMILES | C1=C(COC(=O)CCCCC(=O)OCC(CC)CCCC)C=CC=C1 |
| InChI | 1S/C21H32O4/c1-3-5-11-18(4-2)16-24-20(22)14-9-10-15-21(23)25-17-19-12-7-6-8-13-19/h6-8,12-13,18H,3-5,9-11,14-17H2,1-2H3 |
| InChIKey | OOUQSWGHJPCRLI-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.995°C at 760 mmHg (Cal.) |
| Flash point | 203.839°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl 2-Ethylhexyl Adipate |