Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (431) 5606-600 | |||
|
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | Benzylidenemalonic Acid |
|---|---|
| Synonyms | 2-(Phenylmethylene)Propanedioic Acid; 2-(Benzylidene)Malonic Acid; 4-09-00-03460 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.17 |
| CAS Registry Number | 584-45-2 |
| EINECS | 209-538-2 |
| SMILES | C1=C(C=C(C(=O)O)C(=O)O)C=CC=C1 |
| InChI | 1S/C10H8O4/c11-9(12)8(10(13)14)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14) |
| InChIKey | KXTAOXNYQGASTA-UHFFFAOYSA-N |
| Density | 1.413g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.964°C at 760 mmHg (Cal.) |
| Flash point | 200.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzylidenemalonic Acid |