|
CAS#: 5845-26-1 Product: Thiazesim No suppilers available for the product. |
| Name | Thiazesim |
|---|---|
| Synonyms | Nsc169509; Sq 10,496; 1,5-Benzothiazepin-4(5H)-One, 5-[2-(Dimethylamino)Ethyl]-2,3-Dihydro-2-Phenyl-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.92 |
| CAS Registry Number | 5845-26-1 |
| SMILES | [H+].C2=C1N(CCN(C)C)C(=O)CC(SC1=CC=C2)C3=CC=CC=C3.[Cl-] |
| InChI | 1S/C19H22N2OS.ClH/c1-20(2)12-13-21-16-10-6-7-11-17(16)23-18(14-19(21)22)15-8-4-3-5-9-15;/h3-11,18H,12-14H2,1-2H3;1H |
| InChIKey | IUZXQGCIJLIGLS-UHFFFAOYSA-N |
| Boiling point | 525°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 271.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiazesim |