Online Database of Chemicals from Around the World
| Name | 4-Cyanophenyl 4'-Heptyl-4-Biphenylcarboxylate |
|---|---|
| Synonyms | 4-Cyanophenyl 4'-heptyl[1,1'-biphenyl]-4-carboxylate # |
| Molecular Structure |  |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.51 |
| CAS Registry Number | 58573-95-8 |
| SMILES | O=C(Oc1ccc(C#N)cc1)c3ccc(c2ccc(cc2)CCCCCCC)cc3 |
| InChI | 1S/C27H27NO2/c1-2-3-4-5-6-7-21-8-12-23(13-9-21)24-14-16-25(17-15-24)27(29)30-26-18-10-22(20-28)11-19-26/h8-19H,2-7H2,1H3 |
| InChIKey | ACLRARDQYSCILU-UHFFFAOYSA-N |
| Density | 1.131g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.316°C at 760 mmHg (Cal.) |
| Flash point | 288.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Cyanophenyl 4'-Heptyl-4-Biphenylcarboxylate |
