Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5,7-Dichloro-4-Methylbenzo[b]Thiophene-3(2H)-One |
|---|---|
| Synonyms | 5,7-Dichloro-4-Methyl-Benzothiophen-3-One; 5,7-Dichloro-4-Methyl-3-Benzothiophenone; St5445292 |
| Molecular Structure | ![CAS#: 5858-19-5， 5,7-Dichloro-4-Methylbenzo[b]Thiophene-3(2H)-One](/moreStructures/5858-19-5.gif) |
| Molecular Formula | C9H6Cl2OS |
| Molecular Weight | 233.11 |
| CAS Registry Number | 5858-19-5 |
| EINECS | 227-487-4 |
| SMILES | C1=C(C2=C(C(=C1Cl)C)C(CS2)=O)Cl |
| InChI | 1S/C9H6Cl2OS/c1-4-5(10)2-6(11)9-8(4)7(12)3-13-9/h2H,3H2,1H3 |
| InChIKey | PYRFUPKTUOWRGF-UHFFFAOYSA-N |
| Density | 1.507g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.518°C at 760 mmHg (Cal.) |
| Flash point | 186.35°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,7-Dichloro-4-Methylbenzo[b]Thiophene-3(2H)-One |