| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | N-[(2-fluorophenyl)methylideneamino]-4-methoxy-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H19FN6O |
| Molecular Weight | 330.36 |
| CAS Registry Number | 5866-56-8 |
| SMILES | COC1=NC(=NC(=N1)N2CCCCC2)NN=CC3=CC=CC=C3F |
| Solubility | 0.9993 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.638, Calc.* |
| Melting point | 183.70 °C |
| Boiling Point | 438.14 °C, 510.9±52.0 °C (760 mmHg), Calc.* |
| Flash Point | 262.8±30.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-[(2-fluorophenyl)methylideneamino]-4-methoxy-6-piperidin-1-yl-1,3,5-triazin-2-amine |