Online Database of Chemicals from Around the World
|
CAS#: 58683-84-4 Product: 3-Methoxy-4-Nitroazobenzene No suppilers available for the product. |
| Name | 3-Methoxy-4-Nitroazobenzene |
|---|---|
| Synonyms | (3-Methoxy-4-Nitro-Phenyl)-Phenyl-Diazene; 3-Methoxy-4-Nitroazobenzene; Azobenzene, 3-Methoxy-4-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 |
| CAS Registry Number | 58683-84-4 |
| SMILES | C1=CC(=CC(=C1[N+]([O-])=O)OC)N=NC2=CC=CC=C2 |
| InChI | 1S/C13H11N3O3/c1-19-13-9-11(7-8-12(13)16(17)18)15-14-10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | OWYKQTDOYDDHKU-UHFFFAOYSA-N |
| Density | 1.253g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.922°C at 760 mmHg (Cal.) |
| Flash point | 218.043°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-4-Nitroazobenzene |