Online Database of Chemicals from Around the World
|
CAS#: 58690-46-3 Product: trans-Oxolane-3,4-Diol Dinitrate No suppilers available for the product. |
| Name | trans-Oxolane-3,4-Diol Dinitrate |
|---|---|
| Synonyms | (4-Nitrooxytetrahydrofuran-3-Yl) Nitrate; Nitric Acid (4-Nitrooxy-3-Tetrahydrofuranyl) Ester; Nitric Acid (4-Nitrooxytetrahydrofuran-3-Yl) Ester |
| Molecular Structure |  |
| Molecular Formula | C4H6N2O7 |
| Molecular Weight | 194.10 |
| CAS Registry Number | 58690-46-3 |
| SMILES | O=[N+](OC1C(O[N+]([O-])=O)COC1)[O-] |
| InChI | 1S/C4H6N2O7/c7-5(8)12-3-1-11-2-4(3)13-6(9)10/h3-4H,1-2H2 |
| InChIKey | NUPHETKTSSIAEZ-UHFFFAOYSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.265°C at 760 mmHg (Cal.) |
| Flash point | 155.454°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-Oxolane-3,4-Diol Dinitrate |