Online Database of Chemicals from Around the World
|
CAS#: 587-14-4 Product: N,N-Diphenylsulfamide No suppilers available for the product. |
| Name | N,N-Diphenylsulfamide |
|---|---|
| Synonyms | (Phenyl-Sulfamoyl-Amino)Benzene; 4-12-00-01076 (Beilstein Handbook Reference); Brn 2808055 |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.30 |
| CAS Registry Number | 587-14-4 |
| SMILES | C1=CC=CC=C1N([S](N)(=O)=O)C2=CC=CC=C2 |
| InChI | 1S/C12H12N2O2S/c13-17(15,16)14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,13,15,16) |
| InChIKey | JNRIMGJUBFEWOW-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.174°C at 760 mmHg (Cal.) |
| Flash point | 206.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diphenylsulfamide |