Online Database of Chemicals from Around the World
|
CAS#: 58704-54-4 Product: Dinitro-o-Xylene No suppilers available for the product. |
| Name | Dinitro-o-Xylene |
|---|---|
| Synonyms | Dinitro-O-Xylene |
| Molecular Structure |  |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 58704-54-4 |
| EINECS | 261-398-1 |
| SMILES | C1=CC=CC(=C1C[N+]([O-])=O)C[N+]([O-])=O |
| InChI | 1S/C8H8N2O4/c11-9(12)5-7-3-1-2-4-8(7)6-10(13)14/h1-4H,5-6H2 |
| InChIKey | QCLAIJAGQWBGCN-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.308°C at 760 mmHg (Cal.) |
| Flash point | 171.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dinitro-o-Xylene |